C35H41IO4Si — CID 23775769
4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-iodo-6-methoxyphenol (PubChem CID 23775769) has the molecular formula C35H41IO4Si and a molecular weight of 680.70 g/mol. Its IUPAC name is 4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 23775769 |
| Molecular Formula | C35H41IO4Si |
| Molecular Weight | 680.70 g/mol |
| Exact Mass | 680.18 |
| IUPAC Name | 4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-iodo-6-methoxyphenol |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1=CCOC1CC/C(C)=C/c1cc(I)c(O)c(OC)c1 |
| InChI | InChI=1S/C35H41IO4Si/c1-25(21-27-22-31(36)34(37)33(23-27)38-6)17-18-32-30(19-20-39-32)26(2)24-40-41(35(3,4)5,28-13-9-7-10-14-28)29-15-11-8-12-16-29/h7-16,19,21-23,32,37H,2,17-18,20,24H2,1,3-6H3/b25-21+ |
| InChIKey | AVSODZNAJBPXHP-NJNXFGOHSA-N |
| XLogP | 7.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.70 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|