C27H26N6O2S — CID 23769880
2-(1H-indol-3-yl)-1-[4-[(4-methylphenyl)methyl]-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethanamine (PubChem CID 23769880) has the molecular formula C27H26N6O2S and a molecular weight of 498.61 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-[4-[(4-methylphenyl)methyl]-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | 2-(1H-indol-3-yl)-1-[4-[(4-methylphenyl)methyl]-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 23769880 |
| Molecular Formula | C27H26N6O2S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-[4-[(4-methylphenyl)methyl]-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethanamine |
| SMILES | Cc1ccc(Cn2c(SCc3ccc([N+](=O)[O-])cc3)nnc2C(N)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H26N6O2S/c1-18-6-8-19(9-7-18)16-32-26(24(28)14-21-15-29-25-5-3-2-4-23(21)25)30-31-27(32)36-17-20-10-12-22(13-11-20)33(34)35/h2-13,15,24,29H,14,16-17,28H2,1H3 |
| InChIKey | COMHBOCXDFNVPS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|