C13H14Br2O4 — CID 23778566
(E,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxyhept-2-enoic acid (PubChem CID 23778566) has the molecular formula C13H14Br2O4 and a molecular weight of 394.06 g/mol. Its IUPAC name is (E,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxyhept-2-enoic acid.
| Compound Name | (E,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxyhept-2-enoic acid |
|---|---|
| PubChem CID | 23778566 |
| Molecular Formula | C13H14Br2O4 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | (E,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxyhept-2-enoic acid |
| SMILES | O=C(O)/C=C/CCC[C@H](O)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C13H14Br2O4/c14-8-6-9(13(19)10(15)7-8)11(16)4-2-1-3-5-12(17)18/h3,5-7,11,16,19H,1-2,4H2,(H,17,18)/b5-3+/t11-/m0/s1 |
| InChIKey | DFBRQGILETUUNI-TZNOJPMFSA-N |
| XLogP | 3.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|