C22H18Cl2O4 — CID 2378058
(4-methylphenyl)methyl 2,2-bis(4-chlorophenoxy)acetate (PubChem CID 2378058) has the molecular formula C22H18Cl2O4 and a molecular weight of 417.29 g/mol. Its IUPAC name is (4-methylphenyl)methyl 2,2-bis(4-chlorophenoxy)acetate.
| Compound Name | (4-methylphenyl)methyl 2,2-bis(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 2378058 |
| Molecular Formula | C22H18Cl2O4 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | (4-methylphenyl)methyl 2,2-bis(4-chlorophenoxy)acetate |
| SMILES | Cc1ccc(COC(=O)C(Oc2ccc(Cl)cc2)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H18Cl2O4/c1-15-2-4-16(5-3-15)14-26-21(25)22(27-19-10-6-17(23)7-11-19)28-20-12-8-18(24)9-13-20/h2-13,22H,14H2,1H3 |
| InChIKey | FMLSFULWHUNBKT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|