C18H28N6O3S — CID 23787222
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(oxolan-2-ylmethyl)-6-thiophen-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 23787222) has the molecular formula C18H28N6O3S and a molecular weight of 408.53 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(oxolan-2-ylmethyl)-6-thiophen-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(oxolan-2-ylmethyl)-6-thiophen-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23787222 |
| Molecular Formula | C18H28N6O3S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-(oxolan-2-ylmethyl)-6-thiophen-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | NCCOCCOCCNc1nc(NCC2CCCO2)nc(-c2cccs2)n1 |
| InChI | InChI=1S/C18H28N6O3S/c19-5-8-25-10-11-26-9-6-20-17-22-16(15-4-2-12-28-15)23-18(24-17)21-13-14-3-1-7-27-14/h2,4,12,14H,1,3,5-11,13,19H2,(H2,20,21,22,23,24) |
| InChIKey | AKMLMHILQURLHD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|