C14H14F3N3OS — CID 6937978
N-[[(2S)-oxolan-2-yl]methyl]-4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 6937978) has the molecular formula C14H14F3N3OS and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 6937978 |
| Molecular Formula | C14H14F3N3OS |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1cc(-c2cccs2)nc(NC[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C14H14F3N3OS/c15-14(16,17)12-7-10(11-4-2-6-22-11)19-13(20-12)18-8-9-3-1-5-21-9/h2,4,6-7,9H,1,3,5,8H2,(H,18,19,20)/t9-/m0/s1 |
| InChIKey | RLROGYDKUGFHHB-VIFPVBQESA-N |
| XLogP | 3.81 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |