C18H12F3N5S — CID 17035779
4-methyl-N-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]quinazolin-2-amine (PubChem CID 17035779) has the molecular formula C18H12F3N5S and a molecular weight of 387.39 g/mol. Its IUPAC name is 4-methyl-N-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]quinazolin-2-amine.
| Compound Name | 4-methyl-N-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 17035779 |
| Molecular Formula | C18H12F3N5S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 4-methyl-N-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]quinazolin-2-amine |
| SMILES | Cc1nc(Nc2nc(-c3cccs3)cc(C(F)(F)F)n2)nc2ccccc12 |
| InChI | InChI=1S/C18H12F3N5S/c1-10-11-5-2-3-6-12(11)23-16(22-10)26-17-24-13(14-7-4-8-27-14)9-15(25-17)18(19,20)21/h2-9H,1H3,(H,22,23,24,25,26) |
| InChIKey | LNPCHKNCUVOUOZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |