C27H45N3O3Si — CID 23788518
2-[1-[2-[(2R,3S,4R,5S)-5-heptyl-3-[(4-methoxyphenyl)-dimethylsilyl]-4-methyloxolan-2-yl]ethyl]triazol-4-yl]ethanol (PubChem CID 23788518) has the molecular formula C27H45N3O3Si and a molecular weight of 487.76 g/mol. Its IUPAC name is 2-[1-[2-[(2R,3S,4R,5S)-5-heptyl-3-[(4-methoxyphenyl)-dimethylsilyl]-4-methyloxolan-2-yl]ethyl]triazol-4-yl]ethanol.
| Compound Name | 2-[1-[2-[(2R,3S,4R,5S)-5-heptyl-3-[(4-methoxyphenyl)-dimethylsilyl]-4-methyloxolan-2-yl]ethyl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 23788518 |
| Molecular Formula | C27H45N3O3Si |
| Molecular Weight | 487.76 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | 2-[1-[2-[(2R,3S,4R,5S)-5-heptyl-3-[(4-methoxyphenyl)-dimethylsilyl]-4-methyloxolan-2-yl]ethyl]triazol-4-yl]ethanol |
| SMILES | CCCCCCC[C@@H]1O[C@H](CCn2cc(CCO)nn2)[C@@H]([Si](C)(C)c2ccc(OC)cc2)[C@@H]1C |
| InChI | InChI=1S/C27H45N3O3Si/c1-6-7-8-9-10-11-25-21(2)27(34(4,5)24-14-12-23(32-3)13-15-24)26(33-25)16-18-30-20-22(17-19-31)28-29-30/h12-15,20-21,25-27,31H,6-11,16-19H2,1-5H3/t21-,25+,26-,27+/m1/s1 |
| InChIKey | VTQNELIRXKHZPD-DXXVALNZSA-N |
| XLogP | 4.96 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.76 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|