C24H26N2O2S — CID 23789774
2-(4-benzylphenoxy)-N-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide (PubChem CID 23789774) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-(4-benzylphenoxy)-N-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-benzylphenoxy)-N-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 23789774 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-(4-benzylphenoxy)-N-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(COc1ccc(Cc2ccccc2)cc1)Nc1nc(C2CCCCC2)cs1 |
| InChI | InChI=1S/C24H26N2O2S/c27-23(26-24-25-22(17-29-24)20-9-5-2-6-10-20)16-28-21-13-11-19(12-14-21)15-18-7-3-1-4-8-18/h1,3-4,7-8,11-14,17,20H,2,5-6,9-10,15-16H2,(H,25,26,27) |
| InChIKey | YDRSIPUHGCGWNF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |