C20H22N2O2S — CID 23823839
[4-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]phenyl] thiocyanate (PubChem CID 23823839) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is [4-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]phenyl] thiocyanate.
| Compound Name | [4-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 23823839 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [4-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]phenyl] thiocyanate |
| SMILES | COc1cc(/C=N/c2ccc(SC#N)cc2)ccc1OCCC(C)C |
| InChI | InChI=1S/C20H22N2O2S/c1-15(2)10-11-24-19-9-4-16(12-20(19)23-3)13-22-17-5-7-18(8-6-17)25-14-21/h4-9,12-13,15H,10-11H2,1-3H3/b22-13+ |
| InChIKey | WQDKVEHSRFVOPO-LPYMAVHISA-N |
| XLogP | 5.44 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|