C20H13FN4O4S2 — CID 23828340
N-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-oxochromene-3-carboxamide (PubChem CID 23828340) has the molecular formula C20H13FN4O4S2 and a molecular weight of 456.48 g/mol. Its IUPAC name is N-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 23828340 |
| Molecular Formula | C20H13FN4O4S2 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | N-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cc3ccccc3oc2=O)s1)Nc1ccccc1F |
| InChI | InChI=1S/C20H13FN4O4S2/c21-13-6-2-3-7-14(13)22-16(26)10-30-20-25-24-19(31-20)23-17(27)12-9-11-5-1-4-8-15(11)29-18(12)28/h1-9H,10H2,(H,22,26)(H,23,24,27) |
| InChIKey | CPJQRQGLTFABMS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|