C18H13N5O5S2 — CID 23934447
N-[5-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-oxochromene-3-carboxamide (PubChem CID 23934447) has the molecular formula C18H13N5O5S2 and a molecular weight of 443.47 g/mol. Its IUPAC name is N-[5-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[5-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 23934447 |
| Molecular Formula | C18H13N5O5S2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | N-[5-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1cc(NC(=O)CSc2nnc(NC(=O)c3cc4ccccc4oc3=O)s2)no1 |
| InChI | InChI=1S/C18H13N5O5S2/c1-9-6-13(23-28-9)19-14(24)8-29-18-22-21-17(30-18)20-15(25)11-7-10-4-2-3-5-12(10)27-16(11)26/h2-7H,8H2,1H3,(H,19,23,24)(H,20,21,25) |
| InChIKey | HAFKJHTVBUNWFO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|