C20H12F3N3O3S2 — CID 44957901
2-oxo-N-[5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide (PubChem CID 44957901) has the molecular formula C20H12F3N3O3S2 and a molecular weight of 463.46 g/mol. Its IUPAC name is 2-oxo-N-[5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 44957901 |
| Molecular Formula | C20H12F3N3O3S2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 2-oxo-N-[5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccc(C(F)(F)F)c2)s1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C20H12F3N3O3S2/c21-20(22,23)13-6-3-4-11(8-13)10-30-19-26-25-18(31-19)24-16(27)14-9-12-5-1-2-7-15(12)29-17(14)28/h1-9H,10H2,(H,24,25,27) |
| InChIKey | LPBHLLAGBLVIFY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|