C20H18N2O5S — CID 23828859
(2-oxooxolan-3-yl) 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate (PubChem CID 23828859) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | (2-oxooxolan-3-yl) 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 23828859 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (2-oxooxolan-3-yl) 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)OC1CCOC1=O)c1cccs1 |
| InChI | InChI=1S/C20H18N2O5S/c23-18(17-6-3-9-28-17)22-15(19(24)27-16-7-8-26-20(16)25)10-12-11-21-14-5-2-1-4-13(12)14/h1-6,9,11,15-16,21H,7-8,10H2,(H,22,23) |
| InChIKey | ZNYXHCBTEVTJKR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |