C35H33FN8O4S — CID 23835975
(4R,5R)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-N-[2-[(4-fluorophenyl)methylsulfanyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23835975) has the molecular formula C35H33FN8O4S and a molecular weight of 680.77 g/mol. Its IUPAC name is (4R,5R)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-N-[2-[(4-fluorophenyl)methylsulfanyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-N-[2-[(4-fluorophenyl)methylsulfanyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23835975 |
| Molecular Formula | C35H33FN8O4S |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.23 |
| IUPAC Name | (4R,5R)-5-(2-azidophenyl)-4-[(2-azidophenyl)methyl]-N-[2-[(4-fluorophenyl)methylsulfanyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@@]1(C(=O)NCCSCc2ccc(F)cc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C35H33FN8O4S/c36-27-14-10-24(11-15-27)23-49-21-18-39-34(46)35(22-26-6-1-3-8-30(26)41-43-37)32(29-7-2-4-9-31(29)42-44-38)48-33(40-35)25-12-16-28(17-13-25)47-20-5-19-45/h1-4,6-17,32,45H,5,18-23H2,(H,39,46)/t32-,35-/m1/s1 |
| InChIKey | PQCQGPXFSQYBBH-FHPVIJFVSA-N |
| XLogP | 8.02 |
| TPSA | 177.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|