C26H20FN3OS2 — CID 2383941
1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanone (PubChem CID 2383941) has the molecular formula C26H20FN3OS2 and a molecular weight of 473.60 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanone.
| Compound Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanone |
|---|---|
| PubChem CID | 2383941 |
| Molecular Formula | C26H20FN3OS2 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanone |
| SMILES | Cc1cc(C(=O)CSc2ncnc3sc(-c4ccccc4)cc23)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H20FN3OS2/c1-16-12-21(17(2)30(16)20-10-8-19(27)9-11-20)23(31)14-32-25-22-13-24(18-6-4-3-5-7-18)33-26(22)29-15-28-25/h3-13,15H,14H2,1-2H3 |
| InChIKey | OZNVNPGYDNUZSN-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|