C25H23BrN2O7S — CID 23844165
[(2S)-2-[(4-bromophenyl)sulfonyl-[(4-methoxyphenyl)methyl]amino]but-3-enyl] 4-nitrobenzoate (PubChem CID 23844165) has the molecular formula C25H23BrN2O7S and a molecular weight of 575.44 g/mol. Its IUPAC name is [(2S)-2-[(4-bromophenyl)sulfonyl-[(4-methoxyphenyl)methyl]amino]but-3-enyl] 4-nitrobenzoate.
| Compound Name | [(2S)-2-[(4-bromophenyl)sulfonyl-[(4-methoxyphenyl)methyl]amino]but-3-enyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 23844165 |
| Molecular Formula | C25H23BrN2O7S |
| Molecular Weight | 575.44 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | [(2S)-2-[(4-bromophenyl)sulfonyl-[(4-methoxyphenyl)methyl]amino]but-3-enyl] 4-nitrobenzoate |
| SMILES | C=C[C@@H](COC(=O)c1ccc([N+](=O)[O-])cc1)N(Cc1ccc(OC)cc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H23BrN2O7S/c1-3-21(17-35-25(29)19-6-10-22(11-7-19)28(30)31)27(16-18-4-12-23(34-2)13-5-18)36(32,33)24-14-8-20(26)9-15-24/h3-15,21H,1,16-17H2,2H3/t21-/m0/s1 |
| InChIKey | CFJARPHMFLPZPD-NRFANRHFSA-N |
| XLogP | 4.97 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|