C26H28F2N4O2 — CID 23850406
N-[(2,4-difluorophenyl)methyl]-4-[[4-(2,5-dimethylpyrrol-1-yl)benzoyl]amino]piperidine-4-carboxamide (PubChem CID 23850406) has the molecular formula C26H28F2N4O2 and a molecular weight of 466.53 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-4-[[4-(2,5-dimethylpyrrol-1-yl)benzoyl]amino]piperidine-4-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-4-[[4-(2,5-dimethylpyrrol-1-yl)benzoyl]amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23850406 |
| Molecular Formula | C26H28F2N4O2 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-4-[[4-(2,5-dimethylpyrrol-1-yl)benzoyl]amino]piperidine-4-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)NC2(C(=O)NCc3ccc(F)cc3F)CCNCC2)cc1 |
| InChI | InChI=1S/C26H28F2N4O2/c1-17-3-4-18(2)32(17)22-9-6-19(7-10-22)24(33)31-26(11-13-29-14-12-26)25(34)30-16-20-5-8-21(27)15-23(20)28/h3-10,15,29H,11-14,16H2,1-2H3,(H,30,34)(H,31,33) |
| InChIKey | XQXZAHINVTXQDY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|