C28H35N5O6 — CID 23854938
3-[[3-(tert-butylamino)-2-(4-methoxy-3-nitrophenyl)imidazo[1,2-a]pyridine-8-carbonyl]amino]-3-cyclohexylpropanoic acid (PubChem CID 23854938) has the molecular formula C28H35N5O6 and a molecular weight of 537.62 g/mol. Its IUPAC name is 3-[[3-(tert-butylamino)-2-(4-methoxy-3-nitrophenyl)imidazo[1,2-a]pyridine-8-carbonyl]amino]-3-cyclohexylpropanoic acid.
| Compound Name | 3-[[3-(tert-butylamino)-2-(4-methoxy-3-nitrophenyl)imidazo[1,2-a]pyridine-8-carbonyl]amino]-3-cyclohexylpropanoic acid |
|---|---|
| PubChem CID | 23854938 |
| Molecular Formula | C28H35N5O6 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 3-[[3-(tert-butylamino)-2-(4-methoxy-3-nitrophenyl)imidazo[1,2-a]pyridine-8-carbonyl]amino]-3-cyclohexylpropanoic acid |
| SMILES | COc1ccc(-c2nc3c(C(=O)NC(CC(=O)O)C4CCCCC4)cccn3c2NC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H35N5O6/c1-28(2,3)31-26-24(18-12-13-22(39-4)21(15-18)33(37)38)30-25-19(11-8-14-32(25)26)27(36)29-20(16-23(34)35)17-9-6-5-7-10-17/h8,11-15,17,20,31H,5-7,9-10,16H2,1-4H3,(H,29,36)(H,34,35) |
| InChIKey | XDKCGOSXXKWRTQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|