C36H45IO7SSi — CID 23862097
4-[(E,5R)-5-[(2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-2-ethyl-5-hydroxypent-1-enyl]-2-iodo-6-methoxyphenol (PubChem CID 23862097) has the molecular formula C36H45IO7SSi and a molecular weight of 776.81 g/mol. Its IUPAC name is 4-[(E,5R)-5-[(2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-2-ethyl-5-hydroxypent-1-enyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(E,5R)-5-[(2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-2-ethyl-5-hydroxypent-1-enyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 23862097 |
| Molecular Formula | C36H45IO7SSi |
| Molecular Weight | 776.81 g/mol |
| Exact Mass | 776.17 |
| IUPAC Name | 4-[(E,5R)-5-[(2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-2-ethyl-5-hydroxypent-1-enyl]-2-iodo-6-methoxyphenol |
| SMILES | CC/C(=C\c1cc(I)c(O)c(OC)c1)CC[C@@H](O)C1=C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CS(=O)(=O)[C@H]1CO |
| InChI | InChI=1S/C36H45IO7SSi/c1-6-25(19-26-20-30(37)35(40)32(21-26)43-5)17-18-31(39)34-27(24-45(41,42)33(34)22-38)23-44-46(36(2,3)4,28-13-9-7-10-14-28)29-15-11-8-12-16-29/h7-16,19-21,31,33,38-40H,6,17-18,22-24H2,1-5H3/b25-19+/t31-,33+/m1/s1 |
| InChIKey | PJVQRMLVFUJCCR-KBHQSTKMSA-N |
| XLogP | 5.60 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.81 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|