C21H16N4 — CID 23879535
N-(1,3-diphenylpyrazol-4-yl)-1-pyridin-3-ylmethanimine (PubChem CID 23879535) has the molecular formula C21H16N4 and a molecular weight of 324.39 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-4-yl)-1-pyridin-3-ylmethanimine.
| Compound Name | N-(1,3-diphenylpyrazol-4-yl)-1-pyridin-3-ylmethanimine |
|---|---|
| PubChem CID | 23879535 |
| Molecular Formula | C21H16N4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-(1,3-diphenylpyrazol-4-yl)-1-pyridin-3-ylmethanimine |
| SMILES | C(=N/c1cn(-c2ccccc2)nc1-c1ccccc1)\c1cccnc1 |
| InChI | InChI=1S/C21H16N4/c1-3-9-18(10-4-1)21-20(23-15-17-8-7-13-22-14-17)16-25(24-21)19-11-5-2-6-12-19/h1-16H/b23-15+ |
| InChIKey | SIKGRVBXNZEBKO-HZHRSRAPSA-N |
| XLogP | 4.68 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|