C21H23N3O3S2 — CID 23880160
3,4-diethoxy-N-[5-(1-phenylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 23880160) has the molecular formula C21H23N3O3S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 3,4-diethoxy-N-[5-(1-phenylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,4-diethoxy-N-[5-(1-phenylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 23880160 |
| Molecular Formula | C21H23N3O3S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 3,4-diethoxy-N-[5-(1-phenylethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2nnc(SC(C)c3ccccc3)s2)cc1OCC |
| InChI | InChI=1S/C21H23N3O3S2/c1-4-26-17-12-11-16(13-18(17)27-5-2)19(25)22-20-23-24-21(29-20)28-14(3)15-9-7-6-8-10-15/h6-14H,4-5H2,1-3H3,(H,22,23,25) |
| InChIKey | DSONWXLFZWFXQD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|