C15H19ClN2O2S — CID 23891607
N'-[(5-chloronaphthalen-1-yl)sulfonylmethyl]butane-1,4-diamine (PubChem CID 23891607) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is N'-[(5-chloronaphthalen-1-yl)sulfonylmethyl]butane-1,4-diamine.
| Compound Name | N'-[(5-chloronaphthalen-1-yl)sulfonylmethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 23891607 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N'-[(5-chloronaphthalen-1-yl)sulfonylmethyl]butane-1,4-diamine |
| SMILES | NCCCCNCS(=O)(=O)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C15H19ClN2O2S/c16-14-7-3-6-13-12(14)5-4-8-15(13)21(19,20)11-18-10-2-1-9-17/h3-8,18H,1-2,9-11,17H2 |
| InChIKey | KENRILRGVWJZRL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|