C23H25ClO2S — CID 58460111
1-chloro-5-(7-phenylheptylsulfonyl)naphthalene (PubChem CID 58460111) has the molecular formula C23H25ClO2S and a molecular weight of 400.97 g/mol. Its IUPAC name is 1-chloro-5-(7-phenylheptylsulfonyl)naphthalene.
| Compound Name | 1-chloro-5-(7-phenylheptylsulfonyl)naphthalene |
|---|---|
| PubChem CID | 58460111 |
| Molecular Formula | C23H25ClO2S |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-chloro-5-(7-phenylheptylsulfonyl)naphthalene |
| SMILES | O=S(=O)(CCCCCCCc1ccccc1)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C23H25ClO2S/c24-22-16-9-15-21-20(22)14-10-17-23(21)27(25,26)18-8-3-1-2-5-11-19-12-6-4-7-13-19/h4,6-7,9-10,12-17H,1-3,5,8,11,18H2 |
| InChIKey | KGNKSRACSDKKEA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|