C26H26F2N2O — CID 23904631
1-[4-[(2,5-difluorophenyl)methyl]-1,4-diazepan-1-yl]-2,2-diphenylethanone (PubChem CID 23904631) has the molecular formula C26H26F2N2O and a molecular weight of 420.50 g/mol. Its IUPAC name is 1-[4-[(2,5-difluorophenyl)methyl]-1,4-diazepan-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-[(2,5-difluorophenyl)methyl]-1,4-diazepan-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 23904631 |
| Molecular Formula | C26H26F2N2O |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-[4-[(2,5-difluorophenyl)methyl]-1,4-diazepan-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCCN(Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C26H26F2N2O/c27-23-12-13-24(28)22(18-23)19-29-14-7-15-30(17-16-29)26(31)25(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-13,18,25H,7,14-17,19H2 |
| InChIKey | UOZQDYQTCPFKFB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |