C23H18Cl2N4O4S — CID 2390603
N-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)imino]-3-[(2,4-dimethylphenyl)sulfamoyl]benzamide (PubChem CID 2390603) has the molecular formula C23H18Cl2N4O4S and a molecular weight of 517.39 g/mol. Its IUPAC name is N-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)imino]-3-[(2,4-dimethylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)imino]-3-[(2,4-dimethylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2390603 |
| Molecular Formula | C23H18Cl2N4O4S |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | N-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)imino]-3-[(2,4-dimethylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)/N=N/c3c(O)[nH]c4c(Cl)cc(Cl)cc34)c2)c(C)c1 |
| InChI | InChI=1S/C23H18Cl2N4O4S/c1-12-6-7-19(13(2)8-12)29-34(32,33)16-5-3-4-14(9-16)22(30)28-27-21-17-10-15(24)11-18(25)20(17)26-23(21)31/h3-11,26,29,31H,1-2H3/b28-27+ |
| InChIKey | QJNCKEMNYMFWMS-BYYHNAKLSA-N |
| XLogP | 6.52 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|