(2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate

C28H23NO3 — CID 23906655

IUPAC(2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate
SMILESO=C(CN(c1ccccc1)c1ccccc1)OC(C(=O)c1ccccc1)c1ccccc1
InChIInChI=1S/C28H23NO3/c30-26(21-29(24-17-9-3-10-18-24)25-19-11-4-12-20-25)32-28(23-15-7-2-8-16-23)27(31)22-13-5-1-6-14-22/h1-20,28H,21H2
InChIKeyLPVFFEDBTLSVPU-UHFFFAOYSA-N
MW421.50 g/mol
LogP5.99
Rot. Bonds8

About (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate

(2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate (PubChem CID 23906655) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate.

Molecular Properties

Compound Name(2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate
PubChem CID23906655
Molecular FormulaC28H23NO3
Molecular Weight421.50 g/mol
Exact Mass421.17
IUPAC Name(2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate
SMILESO=C(CN(c1ccccc1)c1ccccc1)OC(C(=O)c1ccccc1)c1ccccc1
InChIInChI=1S/C28H23NO3/c30-26(21-29(24-17-9-3-10-18-24)25-19-11-4-12-20-25)32-28(23-15-7-2-8-16-23)27(31)22-13-5-1-6-14-22/h1-20,28H,21H2
InChIKeyLPVFFEDBTLSVPU-UHFFFAOYSA-N
XLogP5.99
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms32
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500421.50
LogP ≤ 55.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate?
The IUPAC name of (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate (CID 23906655) is (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate.
What is the SMILES notation for (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate?
The canonical SMILES for (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate is O=C(CN(c1ccccc1)c1ccccc1)OC(C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate?
The InChIKey is LPVFFEDBTLSVPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23NO3/c30-26(21-29(24-17-9-3-10-18-24)25-19-11-4-12-20-25)32-28(23-15-7-2-8-16-23)27(31)22-13-5-1-6-14-22/h1-20,28H,21H2.
What are the key properties of (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate?
(2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate has a molecular weight of 421.50 g/mol, XLogP of 5.99, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,2-diphenylethyl) 2-(N-phenylanilino)acetate is sourced from PubChem (CID 23906655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).