C26H19Cl3N2O3 — CID 23911689
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 3-methyl-2-phenylquinoline-4-carboxylate (PubChem CID 23911689) has the molecular formula C26H19Cl3N2O3 and a molecular weight of 513.81 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 3-methyl-2-phenylquinoline-4-carboxylate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 3-methyl-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23911689 |
| Molecular Formula | C26H19Cl3N2O3 |
| Molecular Weight | 513.81 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 3-methyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)OC(C)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C26H19Cl3N2O3/c1-14-23(17-10-6-7-11-21(17)30-24(14)16-8-4-3-5-9-16)26(33)34-15(2)25(32)31-22-13-19(28)18(27)12-20(22)29/h3-13,15H,1-2H3,(H,31,32) |
| InChIKey | GVYDKLQWYJZGHY-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.81 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|