C27H23N5O4S3 — CID 23913318
2-[[3-(3,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 23913318) has the molecular formula C27H23N5O4S3 and a molecular weight of 577.71 g/mol. Its IUPAC name is 2-[[3-(3,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[[3-(3,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 23913318 |
| Molecular Formula | C27H23N5O4S3 |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 2-[[3-(3,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1cc(C)cc(-n2c(SCC(=O)Nc3nc4ccc([N+](=O)[O-])cc4s3)nc3sc4c(c3c2=O)CCCC4)c1 |
| InChI | InChI=1S/C27H23N5O4S3/c1-14-9-15(2)11-17(10-14)31-25(34)23-18-5-3-4-6-20(18)38-24(23)30-27(31)37-13-22(33)29-26-28-19-8-7-16(32(35)36)12-21(19)39-26/h7-12H,3-6,13H2,1-2H3,(H,28,29,33) |
| InChIKey | FDHHQDORLYYUGI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|