C28H22ClN5O4S3 — CID 3323592
N-[5-[(2-chloro-4-nitrophenyl)methyl]-1,3-thiazol-2-yl]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 3323592) has the molecular formula C28H22ClN5O4S3 and a molecular weight of 624.17 g/mol. Its IUPAC name is N-[5-[(2-chloro-4-nitrophenyl)methyl]-1,3-thiazol-2-yl]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[5-[(2-chloro-4-nitrophenyl)methyl]-1,3-thiazol-2-yl]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3323592 |
| Molecular Formula | C28H22ClN5O4S3 |
| Molecular Weight | 624.17 g/mol |
| Exact Mass | 623.05 |
| IUPAC Name | N-[5-[(2-chloro-4-nitrophenyl)methyl]-1,3-thiazol-2-yl]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2sc3c(c2c(=O)n1-c1ccccc1)CCCC3)Nc1ncc(Cc2ccc([N+](=O)[O-])cc2Cl)s1 |
| InChI | InChI=1S/C28H22ClN5O4S3/c29-21-13-18(34(37)38)11-10-16(21)12-19-14-30-27(40-19)31-23(35)15-39-28-32-25-24(20-8-4-5-9-22(20)41-25)26(36)33(28)17-6-2-1-3-7-17/h1-3,6-7,10-11,13-14H,4-5,8-9,12,15H2,(H,30,31,35) |
| InChIKey | ODROKCQVMKNSAY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.17 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|