C26H24FN3O8S — CID 23937728
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate (PubChem CID 23937728) has the molecular formula C26H24FN3O8S and a molecular weight of 557.56 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 23937728 |
| Molecular Formula | C26H24FN3O8S |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)CC1c2ccccc2CCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H24FN3O8S/c1-37-24-14-19(30(33)34)8-11-22(24)28-25(31)16-38-26(32)15-23-21-5-3-2-4-17(21)12-13-29(23)39(35,36)20-9-6-18(27)7-10-20/h2-11,14,23H,12-13,15-16H2,1H3,(H,28,31) |
| InChIKey | LJMCGGWZNYOLSL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|