C27H25FN4O8S — CID 23996628
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-[2-(4-acetamidophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate (PubChem CID 23996628) has the molecular formula C27H25FN4O8S and a molecular weight of 584.58 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-[2-(4-acetamidophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-[2-(4-acetamidophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 23996628 |
| Molecular Formula | C27H25FN4O8S |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-[2-(4-acetamidophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3C2CC(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2F)cc1 |
| InChI | InChI=1S/C27H25FN4O8S/c1-17(33)29-19-6-9-21(10-7-19)41(38,39)31-13-12-18-4-2-3-5-22(18)25(31)15-27(35)40-16-26(34)30-24-14-20(32(36)37)8-11-23(24)28/h2-11,14,25H,12-13,15-16H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | QGINFTKLFVJPMK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|