C25H22FN3O7S — CID 2416649
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-[(1S)-2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate (PubChem CID 2416649) has the molecular formula C25H22FN3O7S and a molecular weight of 527.53 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-[(1S)-2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-[(1S)-2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 2416649 |
| Molecular Formula | C25H22FN3O7S |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-[(1S)-2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1c2ccccc2CCN1S(=O)(=O)c1ccccc1)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C25H22FN3O7S/c26-21-11-10-18(29(32)33)14-22(21)27-24(30)16-36-25(31)15-23-20-9-5-4-6-17(20)12-13-28(23)37(34,35)19-7-2-1-3-8-19/h1-11,14,23H,12-13,15-16H2,(H,27,30)/t23-/m0/s1 |
| InChIKey | QKCCLVFKJIRVQF-QHCPKHFHSA-N |
| XLogP | 3.59 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|