C26H25N3O8S — CID 3611026
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate (PubChem CID 3611026) has the molecular formula C26H25N3O8S and a molecular weight of 539.57 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 3611026 |
| Molecular Formula | C26H25N3O8S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)CC1c2ccccc2CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25N3O8S/c1-36-24-15-19(29(32)33)11-12-22(24)27-25(30)17-37-26(31)16-23-21-10-6-5-7-18(21)13-14-28(23)38(34,35)20-8-3-2-4-9-20/h2-12,15,23H,13-14,16-17H2,1H3,(H,27,30) |
| InChIKey | OCJUYUPOWXRAQK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|