C7H12N4O2 — CID 23938023
5-amino-N-(2-hydroxyethyl)-3-methylimidazole-4-carboxamide (PubChem CID 23938023) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 5-amino-N-(2-hydroxyethyl)-3-methylimidazole-4-carboxamide.
| Compound Name | 5-amino-N-(2-hydroxyethyl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 23938023 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 5-amino-N-(2-hydroxyethyl)-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(N)c1C(=O)NCCO |
| InChI | InChI=1S/C7H12N4O2/c1-11-4-10-6(8)5(11)7(13)9-2-3-12/h4,12H,2-3,8H2,1H3,(H,9,13) |
| InChIKey | RGNBFOKIYVLSPB-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |