C28H21Cl2NO5S — CID 23945506
[4-[(2,5-dichlorophenyl)sulfonyl-(4-methylbenzoyl)amino]phenyl] 4-methylbenzoate (PubChem CID 23945506) has the molecular formula C28H21Cl2NO5S and a molecular weight of 554.45 g/mol. Its IUPAC name is [4-[(2,5-dichlorophenyl)sulfonyl-(4-methylbenzoyl)amino]phenyl] 4-methylbenzoate.
| Compound Name | [4-[(2,5-dichlorophenyl)sulfonyl-(4-methylbenzoyl)amino]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 23945506 |
| Molecular Formula | C28H21Cl2NO5S |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 553.05 |
| IUPAC Name | [4-[(2,5-dichlorophenyl)sulfonyl-(4-methylbenzoyl)amino]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(N(C(=O)c3ccc(C)cc3)S(=O)(=O)c3cc(Cl)ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H21Cl2NO5S/c1-18-3-7-20(8-4-18)27(32)31(37(34,35)26-17-22(29)11-16-25(26)30)23-12-14-24(15-13-23)36-28(33)21-9-5-19(2)6-10-21/h3-17H,1-2H3 |
| InChIKey | PIXGCPRISYNKJV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|