C29H22ClNO7S — CID 23994055
2-chloro-5-[(4-methylbenzoyl)-[4-(4-methylbenzoyl)oxyphenyl]sulfamoyl]benzoic acid (PubChem CID 23994055) has the molecular formula C29H22ClNO7S and a molecular weight of 564.02 g/mol. Its IUPAC name is 2-chloro-5-[(4-methylbenzoyl)-[4-(4-methylbenzoyl)oxyphenyl]sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-5-[(4-methylbenzoyl)-[4-(4-methylbenzoyl)oxyphenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 23994055 |
| Molecular Formula | C29H22ClNO7S |
| Molecular Weight | 564.02 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | 2-chloro-5-[(4-methylbenzoyl)-[4-(4-methylbenzoyl)oxyphenyl]sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(C(=O)Oc2ccc(N(C(=O)c3ccc(C)cc3)S(=O)(=O)c3ccc(Cl)c(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C29H22ClNO7S/c1-18-3-7-20(8-4-18)27(32)31(39(36,37)24-15-16-26(30)25(17-24)28(33)34)22-11-13-23(14-12-22)38-29(35)21-9-5-19(2)6-10-21/h3-17H,1-2H3,(H,33,34) |
| InChIKey | GMRABLNLVVTQBQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.02 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|