C30H30N2O3 — CID 23960204
2-[[5-(4-ethylphenyl)-3,3,5-trimethyl-1-oxo-4H-2-benzazepin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 23960204) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[[5-(4-ethylphenyl)-3,3,5-trimethyl-1-oxo-4H-2-benzazepin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-(4-ethylphenyl)-3,3,5-trimethyl-1-oxo-4H-2-benzazepin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23960204 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 2-[[5-(4-ethylphenyl)-3,3,5-trimethyl-1-oxo-4H-2-benzazepin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | CCc1ccc(C2(C)CC(C)(C)N(CN3C(=O)c4ccccc4C3=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H30N2O3/c1-5-20-14-16-21(17-15-20)30(4)18-29(2,3)32(28(35)24-12-8-9-13-25(24)30)19-31-26(33)22-10-6-7-11-23(22)27(31)34/h6-17H,5,18-19H2,1-4H3 |
| InChIKey | FIYJWSYHRLFEBT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|