C28H38N4O4 — CID 23961868
3-[[3-amino-4-[4-(3,3-dimethylbutanoyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-(4-methylphenyl)propanoic acid (PubChem CID 23961868) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is 3-[[3-amino-4-[4-(3,3-dimethylbutanoyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-(4-methylphenyl)propanoic acid.
| Compound Name | 3-[[3-amino-4-[4-(3,3-dimethylbutanoyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 23961868 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 3-[[3-amino-4-[4-(3,3-dimethylbutanoyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-(4-methylphenyl)propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)NC(=O)c2ccc(N3CCCN(C(=O)CC(C)(C)C)CC3)c(N)c2)cc1 |
| InChI | InChI=1S/C28H38N4O4/c1-19-6-8-20(9-7-19)23(17-26(34)35)30-27(36)21-10-11-24(22(29)16-21)31-12-5-13-32(15-14-31)25(33)18-28(2,3)4/h6-11,16,23H,5,12-15,17-18,29H2,1-4H3,(H,30,36)(H,34,35) |
| InChIKey | LPWXAQSXKDYPIV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|