C27H27FN4O4 — CID 23988049
3-[[3-amino-4-(4-benzoylpiperazin-1-yl)benzoyl]amino]-3-(4-fluorophenyl)propanoic acid (PubChem CID 23988049) has the molecular formula C27H27FN4O4 and a molecular weight of 490.54 g/mol. Its IUPAC name is 3-[[3-amino-4-(4-benzoylpiperazin-1-yl)benzoyl]amino]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 3-[[3-amino-4-(4-benzoylpiperazin-1-yl)benzoyl]amino]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 23988049 |
| Molecular Formula | C27H27FN4O4 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 3-[[3-amino-4-(4-benzoylpiperazin-1-yl)benzoyl]amino]-3-(4-fluorophenyl)propanoic acid |
| SMILES | Nc1cc(C(=O)NC(CC(=O)O)c2ccc(F)cc2)ccc1N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H27FN4O4/c28-21-9-6-18(7-10-21)23(17-25(33)34)30-26(35)20-8-11-24(22(29)16-20)31-12-14-32(15-13-31)27(36)19-4-2-1-3-5-19/h1-11,16,23H,12-15,17,29H2,(H,30,35)(H,33,34) |
| InChIKey | GCTNZHVAHZMSEK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|