C28H27FN4O6 — CID 23733763
3-[[4-(4-benzoyl-1,4-diazepan-1-yl)-3-nitrobenzoyl]amino]-3-(4-fluorophenyl)propanoic acid (PubChem CID 23733763) has the molecular formula C28H27FN4O6 and a molecular weight of 534.54 g/mol. Its IUPAC name is 3-[[4-(4-benzoyl-1,4-diazepan-1-yl)-3-nitrobenzoyl]amino]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 3-[[4-(4-benzoyl-1,4-diazepan-1-yl)-3-nitrobenzoyl]amino]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 23733763 |
| Molecular Formula | C28H27FN4O6 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 3-[[4-(4-benzoyl-1,4-diazepan-1-yl)-3-nitrobenzoyl]amino]-3-(4-fluorophenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(N2CCCN(C(=O)c3ccccc3)CC2)c([N+](=O)[O-])c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H27FN4O6/c29-22-10-7-19(8-11-22)23(18-26(34)35)30-27(36)21-9-12-24(25(17-21)33(38)39)31-13-4-14-32(16-15-31)28(37)20-5-2-1-3-6-20/h1-3,5-12,17,23H,4,13-16,18H2,(H,30,36)(H,34,35) |
| InChIKey | XKOZAASBKUTRCG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|