C25H28N4O6 — CID 23878525
3-[[4-[4-(cyclopropanecarbonyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-(4-methylphenyl)propanoic acid (PubChem CID 23878525) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 3-[[4-[4-(cyclopropanecarbonyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-(4-methylphenyl)propanoic acid.
| Compound Name | 3-[[4-[4-(cyclopropanecarbonyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 23878525 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[[4-[4-(cyclopropanecarbonyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-(4-methylphenyl)propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)NC(=O)c2ccc(N3CCN(C(=O)C4CC4)CC3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H28N4O6/c1-16-2-4-17(5-3-16)20(15-23(30)31)26-24(32)19-8-9-21(22(14-19)29(34)35)27-10-12-28(13-11-27)25(33)18-6-7-18/h2-5,8-9,14,18,20H,6-7,10-13,15H2,1H3,(H,26,32)(H,30,31) |
| InChIKey | LXQFRGGYNNMSGG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|