C27H25N5O8 — CID 23885326
3-[[4-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 23885326) has the molecular formula C27H25N5O8 and a molecular weight of 547.52 g/mol. Its IUPAC name is 3-[[4-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[4-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 23885326 |
| Molecular Formula | C27H25N5O8 |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 3-[[4-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(N2CCN(C(=O)c3ccc4c(c3)OCO4)CC2)c([N+](=O)[O-])c1)c1cccnc1 |
| InChI | InChI=1S/C27H25N5O8/c33-25(34)14-20(19-2-1-7-28-15-19)29-26(35)17-3-5-21(22(12-17)32(37)38)30-8-10-31(11-9-30)27(36)18-4-6-23-24(13-18)40-16-39-23/h1-7,12-13,15,20H,8-11,14,16H2,(H,29,35)(H,33,34) |
| InChIKey | PUSPRRUOHRQEER-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 164.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|