C28H28N6O8 — CID 23761023
3-[[4-(4-methoxycarbonylpiperazin-1-yl)-3-[(4-nitrobenzoyl)amino]benzoyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 23761023) has the molecular formula C28H28N6O8 and a molecular weight of 576.57 g/mol. Its IUPAC name is 3-[[4-(4-methoxycarbonylpiperazin-1-yl)-3-[(4-nitrobenzoyl)amino]benzoyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[4-(4-methoxycarbonylpiperazin-1-yl)-3-[(4-nitrobenzoyl)amino]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 23761023 |
| Molecular Formula | C28H28N6O8 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 3-[[4-(4-methoxycarbonylpiperazin-1-yl)-3-[(4-nitrobenzoyl)amino]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | COC(=O)N1CCN(c2ccc(C(=O)NC(CC(=O)O)c3cccnc3)cc2NC(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C28H28N6O8/c1-42-28(39)33-13-11-32(12-14-33)24-9-6-19(27(38)30-22(16-25(35)36)20-3-2-10-29-17-20)15-23(24)31-26(37)18-4-7-21(8-5-18)34(40)41/h2-10,15,17,22H,11-14,16H2,1H3,(H,30,38)(H,31,37)(H,35,36) |
| InChIKey | MWWVGDDEEQKCLO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 184.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|