C27H24N6O6 — CID 23738499
3-[[4-[4-(4-cyanobenzoyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 23738499) has the molecular formula C27H24N6O6 and a molecular weight of 528.53 g/mol. Its IUPAC name is 3-[[4-[4-(4-cyanobenzoyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[4-[4-(4-cyanobenzoyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 23738499 |
| Molecular Formula | C27H24N6O6 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 3-[[4-[4-(4-cyanobenzoyl)piperazin-1-yl]-3-nitrobenzoyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | N#Cc1ccc(C(=O)N2CCN(c3ccc(C(=O)NC(CC(=O)O)c4cccnc4)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C27H24N6O6/c28-16-18-3-5-19(6-4-18)27(37)32-12-10-31(11-13-32)23-8-7-20(14-24(23)33(38)39)26(36)30-22(15-25(34)35)21-2-1-9-29-17-21/h1-9,14,17,22H,10-13,15H2,(H,30,36)(H,34,35) |
| InChIKey | CVLXRPNTFYXYGG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 169.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|