C24H23N5O6S — CID 23991633
3-[[3-nitro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 23991633) has the molecular formula C24H23N5O6S and a molecular weight of 509.54 g/mol. Its IUPAC name is 3-[[3-nitro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[3-nitro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 23991633 |
| Molecular Formula | C24H23N5O6S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 3-[[3-nitro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(N2CCN(C(=O)c3cccs3)CC2)c([N+](=O)[O-])c1)c1cccnc1 |
| InChI | InChI=1S/C24H23N5O6S/c30-22(31)14-18(17-3-1-7-25-15-17)26-23(32)16-5-6-19(20(13-16)29(34)35)27-8-10-28(11-9-27)24(33)21-4-2-12-36-21/h1-7,12-13,15,18H,8-11,14H2,(H,26,32)(H,30,31) |
| InChIKey | NLZZFCWTLGZZDM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|