C29H30N6O8 — CID 23881269
3-[[4-(4-methoxycarbonyl-1,4-diazepan-1-yl)-3-[(4-nitrobenzoyl)amino]benzoyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 23881269) has the molecular formula C29H30N6O8 and a molecular weight of 590.59 g/mol. Its IUPAC name is 3-[[4-(4-methoxycarbonyl-1,4-diazepan-1-yl)-3-[(4-nitrobenzoyl)amino]benzoyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[4-(4-methoxycarbonyl-1,4-diazepan-1-yl)-3-[(4-nitrobenzoyl)amino]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 23881269 |
| Molecular Formula | C29H30N6O8 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 3-[[4-(4-methoxycarbonyl-1,4-diazepan-1-yl)-3-[(4-nitrobenzoyl)amino]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | COC(=O)N1CCCN(c2ccc(C(=O)NC(CC(=O)O)c3cccnc3)cc2NC(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C29H30N6O8/c1-43-29(40)34-13-3-12-33(14-15-34)25-10-7-20(28(39)31-23(17-26(36)37)21-4-2-11-30-18-21)16-24(25)32-27(38)19-5-8-22(9-6-19)35(41)42/h2,4-11,16,18,23H,3,12-15,17H2,1H3,(H,31,39)(H,32,38)(H,36,37) |
| InChIKey | SERLDINTXSIEPF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 184.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|