C32H35N7O8 — CID 23962336
3-[[3-[(4-nitrophenyl)carbamoylamino]-4-[4-(oxolane-2-carbonyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 23962336) has the molecular formula C32H35N7O8 and a molecular weight of 645.67 g/mol. Its IUPAC name is 3-[[3-[(4-nitrophenyl)carbamoylamino]-4-[4-(oxolane-2-carbonyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[3-[(4-nitrophenyl)carbamoylamino]-4-[4-(oxolane-2-carbonyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 23962336 |
| Molecular Formula | C32H35N7O8 |
| Molecular Weight | 645.67 g/mol |
| Exact Mass | 645.25 |
| IUPAC Name | 3-[[3-[(4-nitrophenyl)carbamoylamino]-4-[4-(oxolane-2-carbonyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(N2CCCN(C(=O)C3CCCO3)CC2)c(NC(=O)Nc2ccc([N+](=O)[O-])cc2)c1)c1cccnc1 |
| InChI | InChI=1S/C32H35N7O8/c40-29(41)19-25(22-4-1-12-33-20-22)35-30(42)21-6-11-27(37-13-3-14-38(16-15-37)31(43)28-5-2-17-47-28)26(18-21)36-32(44)34-23-7-9-24(10-8-23)39(45)46/h1,4,6-12,18,20,25,28H,2-3,5,13-17,19H2,(H,35,42)(H,40,41)(H2,34,36,44) |
| InChIKey | WPMVFLHJXFEGJE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 196.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|