C26H24FN5O6 — CID 23818823
3-(4-fluorophenyl)-3-[[3-nitro-4-[4-(pyridine-3-carbonyl)piperazin-1-yl]benzoyl]amino]propanoic acid (PubChem CID 23818823) has the molecular formula C26H24FN5O6 and a molecular weight of 521.51 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-[[3-nitro-4-[4-(pyridine-3-carbonyl)piperazin-1-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-3-[[3-nitro-4-[4-(pyridine-3-carbonyl)piperazin-1-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23818823 |
| Molecular Formula | C26H24FN5O6 |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 3-(4-fluorophenyl)-3-[[3-nitro-4-[4-(pyridine-3-carbonyl)piperazin-1-yl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(N2CCN(C(=O)c3cccnc3)CC2)c([N+](=O)[O-])c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H24FN5O6/c27-20-6-3-17(4-7-20)21(15-24(33)34)29-25(35)18-5-8-22(23(14-18)32(37)38)30-10-12-31(13-11-30)26(36)19-2-1-9-28-16-19/h1-9,14,16,21H,10-13,15H2,(H,29,35)(H,33,34) |
| InChIKey | VFYTYPBDHXHTKL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|