C28H29N5O6 — CID 23738786
3-[[3-amino-4-[4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 23738786) has the molecular formula C28H29N5O6 and a molecular weight of 531.57 g/mol. Its IUPAC name is 3-[[3-amino-4-[4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[3-amino-4-[4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 23738786 |
| Molecular Formula | C28H29N5O6 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 3-[[3-amino-4-[4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepan-1-yl]benzoyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | Nc1cc(C(=O)NC(CC(=O)O)c2cccnc2)ccc1N1CCCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C28H29N5O6/c29-21-13-18(27(36)31-22(15-26(34)35)20-3-1-8-30-16-20)4-6-23(21)32-9-2-10-33(12-11-32)28(37)19-5-7-24-25(14-19)39-17-38-24/h1,3-8,13-14,16,22H,2,9-12,15,17,29H2,(H,31,36)(H,34,35) |
| InChIKey | LRGYIJMIDVNAEI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|